C47H85NO6 — CID 166716160
[2-[3-(diethylamino)propanoyloxymethyl]-3-[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 166716160) has the molecular formula C47H85NO6 and a molecular weight of 760.20 g/mol. Its IUPAC name is [2-[3-(diethylamino)propanoyloxymethyl]-3-[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[3-(diethylamino)propanoyloxymethyl]-3-[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 166716160 |
| Molecular Formula | C47H85NO6 |
| Molecular Weight | 760.20 g/mol |
| Exact Mass | 759.64 |
| IUPAC Name | [2-[3-(diethylamino)propanoyloxymethyl]-3-[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCN(CC)CC)COC(O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C47H85NO6/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-45(49)52-41-44(43-54-47(51)39-40-48(7-3)8-4)42-53-46(50)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h15-18,21-24,44-45,49H,5-14,19-20,25-43H2,1-4H3/b17-15-,18-16-,23-21-,24-22- |
| InChIKey | MHABWTPPPSMQFG-MLLZQYMOSA-N |
| XLogP | 12.38 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.20 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|