C47H83NO6 — CID 157385152
(9Z,12Z,27Z,30Z)-20-[3-(diethylamino)propanoyloxymethyl]nonatriaconta-9,12,27,30-tetraenedioic acid (PubChem CID 157385152) has the molecular formula C47H83NO6 and a molecular weight of 758.18 g/mol. Its IUPAC name is (9Z,12Z,27Z,30Z)-20-[3-(diethylamino)propanoyloxymethyl]nonatriaconta-9,12,27,30-tetraenedioic acid.
| Compound Name | (9Z,12Z,27Z,30Z)-20-[3-(diethylamino)propanoyloxymethyl]nonatriaconta-9,12,27,30-tetraenedioic acid |
|---|---|
| PubChem CID | 157385152 |
| Molecular Formula | C47H83NO6 |
| Molecular Weight | 758.18 g/mol |
| Exact Mass | 757.62 |
| IUPAC Name | (9Z,12Z,27Z,30Z)-20-[3-(diethylamino)propanoyloxymethyl]nonatriaconta-9,12,27,30-tetraenedioic acid |
| SMILES | CCN(CC)CCC(=O)OCC(CCCCCC/C=C\C/C=C\CCCCCCCC(=O)O)CCCCCC/C=C\C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C47H83NO6/c1-3-48(4-2)42-41-47(53)54-43-44(37-33-29-25-21-17-13-9-5-7-11-15-19-23-27-31-35-39-45(49)50)38-34-30-26-22-18-14-10-6-8-12-16-20-24-28-32-36-40-46(51)52/h7-14,44H,3-6,15-43H2,1-2H3,(H,49,50)(H,51,52)/b11-7-,12-8-,13-9-,14-10- |
| InChIKey | BLIPNMXZHIPUOI-OIRSPXBMSA-N |
| XLogP | 13.19 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.18 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|