C48H92N2O4 — CID 171658680
2-[3-[3-(diethylamino)propyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 2-octyldecanoate (PubChem CID 171658680) has the molecular formula C48H92N2O4 and a molecular weight of 761.27 g/mol. Its IUPAC name is 2-[3-[3-(diethylamino)propyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 2-octyldecanoate.
| Compound Name | 2-[3-[3-(diethylamino)propyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 2-octyldecanoate |
|---|---|
| PubChem CID | 171658680 |
| Molecular Formula | C48H92N2O4 |
| Molecular Weight | 761.27 g/mol |
| Exact Mass | 760.71 |
| IUPAC Name | 2-[3-[3-(diethylamino)propyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 2-octyldecanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCN(CC)CC)CCC(=O)OCCOC(=O)C(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C48H92N2O4/c1-6-11-14-17-20-21-22-23-24-25-26-27-28-29-32-35-40-50(42-36-41-49(9-4)10-5)43-39-47(51)53-44-45-54-48(52)46(37-33-30-18-15-12-7-2)38-34-31-19-16-13-8-3/h20-21,23-24,46H,6-19,22,25-45H2,1-5H3/b21-20-,24-23- |
| InChIKey | YIGABWDRRYXIBB-IFLFXUNCSA-N |
| XLogP | 13.43 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.27 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|