C43H81NO7 — CID 171659001
2-[3-[4-hydroxybutyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate (PubChem CID 171659001) has the molecular formula C43H81NO7 and a molecular weight of 724.12 g/mol. Its IUPAC name is 2-[3-[4-hydroxybutyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate.
| Compound Name | 2-[3-[4-hydroxybutyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate |
|---|---|
| PubChem CID | 171659001 |
| Molecular Formula | C43H81NO7 |
| Molecular Weight | 724.12 g/mol |
| Exact Mass | 723.60 |
| IUPAC Name | 2-[3-[4-hydroxybutyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCCO)CCC(=O)OCCOC(=O)CCC(OCCCCCC)OCCCCCC |
| InChI | InChI=1S/C43H81NO7/c1-4-7-10-13-14-15-16-17-18-19-20-21-22-23-24-25-33-44(34-26-27-36-45)35-32-42(47)49-40-39-48-41(46)30-31-43(50-37-28-11-8-5-2)51-38-29-12-9-6-3/h14-15,17-18,43,45H,4-13,16,19-40H2,1-3H3/b15-14-,18-17- |
| InChIKey | MIUFXRMSANOAQD-NFYLBXPESA-N |
| XLogP | 10.65 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.12 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|