C58H107NO9 — CID 164552250
6-[6-[4,4-bis[(Z)-non-2-enoxy]butanoyloxy]hexyl-(2-hydroxyethyl)amino]hexyl 4,4-bis[(Z)-non-2-enoxy]butanoate (PubChem CID 164552250) has the molecular formula C58H107NO9 and a molecular weight of 962.49 g/mol. Its IUPAC name is 6-[6-[4,4-bis[(Z)-non-2-enoxy]butanoyloxy]hexyl-(2-hydroxyethyl)amino]hexyl 4,4-bis[(Z)-non-2-enoxy]butanoate.
| Compound Name | 6-[6-[4,4-bis[(Z)-non-2-enoxy]butanoyloxy]hexyl-(2-hydroxyethyl)amino]hexyl 4,4-bis[(Z)-non-2-enoxy]butanoate |
|---|---|
| PubChem CID | 164552250 |
| Molecular Formula | C58H107NO9 |
| Molecular Weight | 962.49 g/mol |
| Exact Mass | 961.79 |
| IUPAC Name | 6-[6-[4,4-bis[(Z)-non-2-enoxy]butanoyloxy]hexyl-(2-hydroxyethyl)amino]hexyl 4,4-bis[(Z)-non-2-enoxy]butanoate |
| SMILES | CCCCCC/C=C\COC(CCC(=O)OCCCCCCN(CCO)CCCCCCOC(=O)CCC(OC/C=C\CCCCCC)OC/C=C\CCCCCC)OC/C=C\CCCCCC |
| InChI | InChI=1S/C58H107NO9/c1-5-9-13-17-21-27-37-51-65-57(66-52-38-28-22-18-14-10-6-2)43-41-55(61)63-49-35-31-25-33-45-59(47-48-60)46-34-26-32-36-50-64-56(62)42-44-58(67-53-39-29-23-19-15-11-7-3)68-54-40-30-24-20-16-12-8-4/h27-30,37-40,57-58,60H,5-26,31-36,41-54H2,1-4H3/b37-27-,38-28-,39-29-,40-30- |
| InChIKey | SZMKZWUGLNJEPP-UFEOBMKASA-N |
| XLogP | 14.87 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.49 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|