C50H91NO9 — CID 164552618
4-[4-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]butyl-(2-hydroxyethyl)amino]butyl 4,4-bis[(Z)-oct-5-enoxy]butanoate (PubChem CID 164552618) has the molecular formula C50H91NO9 and a molecular weight of 850.28 g/mol. Its IUPAC name is 4-[4-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]butyl-(2-hydroxyethyl)amino]butyl 4,4-bis[(Z)-oct-5-enoxy]butanoate.
| Compound Name | 4-[4-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]butyl-(2-hydroxyethyl)amino]butyl 4,4-bis[(Z)-oct-5-enoxy]butanoate |
|---|---|
| PubChem CID | 164552618 |
| Molecular Formula | C50H91NO9 |
| Molecular Weight | 850.28 g/mol |
| Exact Mass | 849.67 |
| IUPAC Name | 4-[4-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]butyl-(2-hydroxyethyl)amino]butyl 4,4-bis[(Z)-oct-5-enoxy]butanoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCCCCN(CCO)CCCCOC(=O)CCC(OCCCC/C=C\CC)OCCCC/C=C\CC)OCCCC/C=C\CC |
| InChI | InChI=1S/C50H91NO9/c1-5-9-13-17-21-27-43-57-49(58-44-28-22-18-14-10-6-2)35-33-47(53)55-41-31-25-37-51(39-40-52)38-26-32-42-56-48(54)34-36-50(59-45-29-23-19-15-11-7-3)60-46-30-24-20-16-12-8-4/h9-16,49-50,52H,5-8,17-46H2,1-4H3/b13-9-,14-10-,15-11-,16-12- |
| InChIKey | GOKFUEKMTRIRGO-NONDJZLBSA-N |
| XLogP | 11.75 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.28 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|