C52H101NO7 — CID 164552565
6-[8,8-bis[(Z)-oct-5-enoxy]octyl-(2-hydroxyethyl)amino]hexyl 4,4-dioctoxybutanoate (PubChem CID 164552565) has the molecular formula C52H101NO7 and a molecular weight of 852.38 g/mol. Its IUPAC name is 6-[8,8-bis[(Z)-oct-5-enoxy]octyl-(2-hydroxyethyl)amino]hexyl 4,4-dioctoxybutanoate.
| Compound Name | 6-[8,8-bis[(Z)-oct-5-enoxy]octyl-(2-hydroxyethyl)amino]hexyl 4,4-dioctoxybutanoate |
|---|---|
| PubChem CID | 164552565 |
| Molecular Formula | C52H101NO7 |
| Molecular Weight | 852.38 g/mol |
| Exact Mass | 851.76 |
| IUPAC Name | 6-[8,8-bis[(Z)-oct-5-enoxy]octyl-(2-hydroxyethyl)amino]hexyl 4,4-dioctoxybutanoate |
| SMILES | CC/C=C\CCCCOC(CCCCCCCN(CCO)CCCCCCOC(=O)CCC(OCCCCCCCC)OCCCCCCCC)OCCCC/C=C\CC |
| InChI | InChI=1S/C52H101NO7/c1-5-9-13-17-25-34-46-57-51(58-47-35-26-18-14-10-6-2)38-30-22-21-23-31-41-53(43-44-54)42-32-24-29-33-45-56-50(55)39-40-52(59-48-36-27-19-15-11-7-3)60-49-37-28-20-16-12-8-4/h9-10,13-14,51-52,54H,5-8,11-12,15-49H2,1-4H3/b13-9-,14-10- |
| InChIKey | KZOUHBAARCFQOH-FOIMCPNXSA-N |
| XLogP | 14.22 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.38 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|