C44H81NO7 — CID 164552312
[(E)-oct-2-enyl] 8-[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl-(2-hydroxyethyl)amino]octanoate (PubChem CID 164552312) has the molecular formula C44H81NO7 and a molecular weight of 736.13 g/mol. Its IUPAC name is [(E)-oct-2-enyl] 8-[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl-(2-hydroxyethyl)amino]octanoate.
| Compound Name | [(E)-oct-2-enyl] 8-[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 164552312 |
| Molecular Formula | C44H81NO7 |
| Molecular Weight | 736.13 g/mol |
| Exact Mass | 735.60 |
| IUPAC Name | [(E)-oct-2-enyl] 8-[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl-(2-hydroxyethyl)amino]octanoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCCCCCCN(CCO)CCCCCCCC(=O)OC/C=C/CCCCC)OCCCC/C=C\CC |
| InChI | InChI=1S/C44H81NO7/c1-4-7-10-13-20-27-38-49-42(47)31-24-17-16-18-25-34-45(36-37-46)35-26-19-23-28-39-50-43(48)32-33-44(51-40-29-21-14-11-8-5-2)52-41-30-22-15-12-9-6-3/h8-9,11-12,20,27,44,46H,4-7,10,13-19,21-26,28-41H2,1-3H3/b11-8-,12-9-,27-20+ |
| InChIKey | ACDAGNRBIZKIFZ-AAEOPZDTSA-N |
| XLogP | 10.82 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.13 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|