C48H91NO7 — CID 164552687
nonyl 10-[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl-(3-hydroxypropyl)amino]decanoate (PubChem CID 164552687) has the molecular formula C48H91NO7 and a molecular weight of 794.26 g/mol. Its IUPAC name is nonyl 10-[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl-(3-hydroxypropyl)amino]decanoate.
| Compound Name | nonyl 10-[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl-(3-hydroxypropyl)amino]decanoate |
|---|---|
| PubChem CID | 164552687 |
| Molecular Formula | C48H91NO7 |
| Molecular Weight | 794.26 g/mol |
| Exact Mass | 793.68 |
| IUPAC Name | nonyl 10-[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl-(3-hydroxypropyl)amino]decanoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCCCCCCN(CCCO)CCCCCCCCCC(=O)OCCCCCCCCC)OCCCC/C=C\CC |
| InChI | InChI=1S/C48H91NO7/c1-4-7-10-13-19-25-30-42-53-46(51)35-27-20-17-16-18-21-28-38-49(40-34-41-50)39-29-22-26-31-43-54-47(52)36-37-48(55-44-32-23-14-11-8-5-2)56-45-33-24-15-12-9-6-3/h8-9,11-12,48,50H,4-7,10,13-45H2,1-3H3/b11-8-,12-9- |
| InChIKey | SGHVGTXXVQLBFU-QAHSQZNUSA-N |
| XLogP | 12.60 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.26 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|