C38H69NO6 — CID 167523648
6-[4-hydroxybutyl(6-hydroxyhexyl)amino]hexyl 4,4-bis[(3E,6E)-nona-3,6-dienoxy]butanoate (PubChem CID 167523648) has the molecular formula C38H69NO6 and a molecular weight of 635.97 g/mol. Its IUPAC name is 6-[4-hydroxybutyl(6-hydroxyhexyl)amino]hexyl 4,4-bis[(3E,6E)-nona-3,6-dienoxy]butanoate.
| Compound Name | 6-[4-hydroxybutyl(6-hydroxyhexyl)amino]hexyl 4,4-bis[(3E,6E)-nona-3,6-dienoxy]butanoate |
|---|---|
| PubChem CID | 167523648 |
| Molecular Formula | C38H69NO6 |
| Molecular Weight | 635.97 g/mol |
| Exact Mass | 635.51 |
| IUPAC Name | 6-[4-hydroxybutyl(6-hydroxyhexyl)amino]hexyl 4,4-bis[(3E,6E)-nona-3,6-dienoxy]butanoate |
| SMILES | CC/C=C/C/C=C/CCOC(CCC(=O)OCCCCCCN(CCCCO)CCCCCCO)OCC/C=C/C/C=C/CC |
| InChI | InChI=1S/C38H69NO6/c1-3-5-7-9-11-16-25-35-44-38(45-36-26-17-12-10-8-6-4-2)28-27-37(42)43-34-24-18-14-20-30-39(31-21-23-33-41)29-19-13-15-22-32-40/h5-8,11-12,16-17,38,40-41H,3-4,9-10,13-15,18-36H2,1-2H3/b7-5+,8-6+,16-11+,17-12+ |
| InChIKey | YMKFNPYEYPIIHN-KZODPVJVSA-N |
| XLogP | 8.46 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.97 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|