C28H47BrO4 — CID 167523667
6-bromohexyl 4,4-bis[(3E,6E)-nona-3,6-dienoxy]butanoate (PubChem CID 167523667) has the molecular formula C28H47BrO4 and a molecular weight of 527.58 g/mol. Its IUPAC name is 6-bromohexyl 4,4-bis[(3E,6E)-nona-3,6-dienoxy]butanoate.
| Compound Name | 6-bromohexyl 4,4-bis[(3E,6E)-nona-3,6-dienoxy]butanoate |
|---|---|
| PubChem CID | 167523667 |
| Molecular Formula | C28H47BrO4 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 6-bromohexyl 4,4-bis[(3E,6E)-nona-3,6-dienoxy]butanoate |
| SMILES | CC/C=C/C/C=C/CCOC(CCC(=O)OCCCCCCBr)OCC/C=C/C/C=C/CC |
| InChI | InChI=1S/C28H47BrO4/c1-3-5-7-9-11-14-19-25-32-28(33-26-20-15-12-10-8-6-4-2)22-21-27(30)31-24-18-16-13-17-23-29/h5-8,11-12,14-15,28H,3-4,9-10,13,16-26H2,1-2H3/b7-5+,8-6+,14-11+,15-12+ |
| InChIKey | NJENGDWLAJBDSI-CUHPVKSJSA-N |
| XLogP | 8.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|