C27H49BrO4 — CID 164552328
7-bromoheptyl 4,4-bis[(Z)-oct-3-enoxy]butanoate (PubChem CID 164552328) has the molecular formula C27H49BrO4 and a molecular weight of 517.59 g/mol. Its IUPAC name is 7-bromoheptyl 4,4-bis[(Z)-oct-3-enoxy]butanoate.
| Compound Name | 7-bromoheptyl 4,4-bis[(Z)-oct-3-enoxy]butanoate |
|---|---|
| PubChem CID | 164552328 |
| Molecular Formula | C27H49BrO4 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 7-bromoheptyl 4,4-bis[(Z)-oct-3-enoxy]butanoate |
| SMILES | CCCC/C=C\CCOC(CCC(=O)OCCCCCCCBr)OCC/C=C\CCCC |
| InChI | InChI=1S/C27H49BrO4/c1-3-5-7-9-13-18-24-31-27(32-25-19-14-10-8-6-4-2)21-20-26(29)30-23-17-15-11-12-16-22-28/h9-10,13-14,27H,3-8,11-12,15-25H2,1-2H3/b13-9-,14-10- |
| InChIKey | SEJNQSCECJYFAI-FOIMCPNXSA-N |
| XLogP | 8.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|