C26H47BrO4 — CID 164552232
6-bromohexyl 4,4-bis[(Z)-oct-5-enoxy]butanoate (PubChem CID 164552232) has the molecular formula C26H47BrO4 and a molecular weight of 503.56 g/mol. Its IUPAC name is 6-bromohexyl 4,4-bis[(Z)-oct-5-enoxy]butanoate.
| Compound Name | 6-bromohexyl 4,4-bis[(Z)-oct-5-enoxy]butanoate |
|---|---|
| PubChem CID | 164552232 |
| Molecular Formula | C26H47BrO4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 6-bromohexyl 4,4-bis[(Z)-oct-5-enoxy]butanoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCCCCCCBr)OCCCC/C=C\CC |
| InChI | InChI=1S/C26H47BrO4/c1-3-5-7-9-12-17-23-30-26(31-24-18-13-10-8-6-4-2)20-19-25(28)29-22-16-14-11-15-21-27/h5-8,26H,3-4,9-24H2,1-2H3/b7-5-,8-6- |
| InChIKey | CRZPXFIHIIVHSI-SFECMWDFSA-N |
| XLogP | 7.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|