C25H47BrO4 — CID 175943916
4,4-bis[(Z)-oct-5-enoxy]butanoic acid;1-bromopentane (PubChem CID 175943916) has the molecular formula C25H47BrO4 and a molecular weight of 491.55 g/mol. Its IUPAC name is 4,4-bis[(Z)-oct-5-enoxy]butanoic acid;1-bromopentane.
| Compound Name | 4,4-bis[(Z)-oct-5-enoxy]butanoic acid;1-bromopentane |
|---|---|
| PubChem CID | 175943916 |
| Molecular Formula | C25H47BrO4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 4,4-bis[(Z)-oct-5-enoxy]butanoic acid;1-bromopentane |
| SMILES | CC/C=C\CCCCOC(CCC(=O)O)OCCCC/C=C\CC.CCCCCBr |
| InChI | InChI=1S/C20H36O4.C5H11Br/c1-3-5-7-9-11-13-17-23-20(16-15-19(21)22)24-18-14-12-10-8-6-4-2;1-2-3-4-5-6/h5-8,20H,3-4,9-18H2,1-2H3,(H,21,22);2-5H2,1H3/b7-5-,8-6-; |
| InChIKey | FNTYDUPXXWYUBC-OVDGFJEXSA-N |
| XLogP | 8.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|