C16H28O4 — CID 159140984
4,4-bis[(Z)-hex-3-enoxy]butanoic acid (PubChem CID 159140984) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 4,4-bis[(Z)-hex-3-enoxy]butanoic acid.
| Compound Name | 4,4-bis[(Z)-hex-3-enoxy]butanoic acid |
|---|---|
| PubChem CID | 159140984 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4,4-bis[(Z)-hex-3-enoxy]butanoic acid |
| SMILES | CC/C=C\CCOC(CCC(=O)O)OCC/C=C\CC |
| InChI | InChI=1S/C16H28O4/c1-3-5-7-9-13-19-16(12-11-15(17)18)20-14-10-8-6-4-2/h5-8,16H,3-4,9-14H2,1-2H3,(H,17,18)/b7-5-,8-6- |
| InChIKey | KIBZDABRRWJOPM-SFECMWDFSA-N |
| XLogP | 3.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|