C13H18O7 — CID 57233367
2-hex-3-enoxycarbonyl-3-oxohexanedioic acid (PubChem CID 57233367) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-hex-3-enoxycarbonyl-3-oxohexanedioic acid.
| Compound Name | 2-hex-3-enoxycarbonyl-3-oxohexanedioic acid |
|---|---|
| PubChem CID | 57233367 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-hex-3-enoxycarbonyl-3-oxohexanedioic acid |
| SMILES | CCC=CCCOC(=O)C(C(=O)O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C13H18O7/c1-2-3-4-5-8-20-13(19)11(12(17)18)9(14)6-7-10(15)16/h3-4,11H,2,5-8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | IYANEAVPIKFGSW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|