C22H34O4 — CID 87561638
2-ethoxy-2-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoxy]acetic acid (PubChem CID 87561638) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-ethoxy-2-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoxy]acetic acid.
| Compound Name | 2-ethoxy-2-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoxy]acetic acid |
|---|---|
| PubChem CID | 87561638 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-ethoxy-2-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoxy]acetic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCOC(OCC)C(=O)O |
| InChI | InChI=1S/C22H34O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26-22(21(23)24)25-4-2/h5-6,8-9,11-12,14-15,17-18,22H,3-4,7,10,13,16,19-20H2,1-2H3,(H,23,24)/b6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | XMSTVWGREKMQDB-AAQCHOMXSA-N |
| XLogP | 5.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|