C21H32O4 — CID 91579093
2-methoxy-2-octadeca-3,6,9,12,15-pentaenoxyacetic acid (PubChem CID 91579093) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 2-methoxy-2-octadeca-3,6,9,12,15-pentaenoxyacetic acid.
| Compound Name | 2-methoxy-2-octadeca-3,6,9,12,15-pentaenoxyacetic acid |
|---|---|
| PubChem CID | 91579093 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-methoxy-2-octadeca-3,6,9,12,15-pentaenoxyacetic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCOC(OC)C(=O)O |
| InChI | InChI=1S/C21H32O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-21(24-2)20(22)23/h4-5,7-8,10-11,13-14,16-17,21H,3,6,9,12,15,18-19H2,1-2H3,(H,22,23) |
| InChIKey | RFVINTHVEGQQBB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|