C21H36O3 — CID 123931723
2-methoxyicosa-11,14,17-trienoic acid (PubChem CID 123931723) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is 2-methoxyicosa-11,14,17-trienoic acid.
| Compound Name | 2-methoxyicosa-11,14,17-trienoic acid |
|---|---|
| PubChem CID | 123931723 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 2-methoxyicosa-11,14,17-trienoic acid |
| SMILES | CCC=CCC=CCC=CCCCCCCCCC(OC)C(=O)O |
| InChI | InChI=1S/C21H36O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(24-2)21(22)23/h4-5,7-8,10-11,20H,3,6,9,12-19H2,1-2H3,(H,22,23) |
| InChIKey | MGGNDVRWPDPTSC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|