C20H31NO4 — CID 89405287
(8E,11E,14E,17E)-2-nitroicosa-8,11,14,17-tetraenoic acid (PubChem CID 89405287) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is (8E,11E,14E,17E)-2-nitroicosa-8,11,14,17-tetraenoic acid.
| Compound Name | (8E,11E,14E,17E)-2-nitroicosa-8,11,14,17-tetraenoic acid |
|---|---|
| PubChem CID | 89405287 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | (8E,11E,14E,17E)-2-nitroicosa-8,11,14,17-tetraenoic acid |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C20H31NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20(22)23)21(24)25/h3-4,6-7,9-10,12-13,19H,2,5,8,11,14-18H2,1H3,(H,22,23)/b4-3+,7-6+,10-9+,13-12+ |
| InChIKey | SPTZXQRZLVWAAU-GFRMADBLSA-N |
| XLogP | 5.47 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|