C35H60O — CID 121330977
(3Z,6Z,9Z,26Z,29Z,32Z)-pentatriaconta-3,6,9,26,29,32-hexaen-18-ol (PubChem CID 121330977) has the molecular formula C35H60O and a molecular weight of 496.86 g/mol. Its IUPAC name is (3Z,6Z,9Z,26Z,29Z,32Z)-pentatriaconta-3,6,9,26,29,32-hexaen-18-ol.
| Compound Name | (3Z,6Z,9Z,26Z,29Z,32Z)-pentatriaconta-3,6,9,26,29,32-hexaen-18-ol |
|---|---|
| PubChem CID | 121330977 |
| Molecular Formula | C35H60O |
| Molecular Weight | 496.86 g/mol |
| Exact Mass | 496.46 |
| IUPAC Name | (3Z,6Z,9Z,26Z,29Z,32Z)-pentatriaconta-3,6,9,26,29,32-hexaen-18-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(O)CCCCCCC/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C35H60O/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(36)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,35-36H,3-4,9-10,15-16,21-34H2,1-2H3/b7-5-,8-6-,13-11-,14-12-,19-17-,20-18- |
| InChIKey | UJDMWLUUVCOZSV-YTWBPVBXSA-N |
| XLogP | 11.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.86 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|