C72H130O2 — CID 158497587
(6Z,9Z,27Z,30Z)-hexatriaconta-6,9,27,30-tetraen-18-ol;(6Z,9Z,27Z,30Z)-hexatriaconta-6,9,27,30-tetraen-18-one (PubChem CID 158497587) has the molecular formula C72H130O2 and a molecular weight of 1027.83 g/mol. Its IUPAC name is (6Z,9Z,27Z,30Z)-hexatriaconta-6,9,27,30-tetraen-18-ol;(6Z,9Z,27Z,30Z)-hexatriaconta-6,9,27,30-tetraen-18-one.
| Compound Name | (6Z,9Z,27Z,30Z)-hexatriaconta-6,9,27,30-tetraen-18-ol;(6Z,9Z,27Z,30Z)-hexatriaconta-6,9,27,30-tetraen-18-one |
|---|---|
| PubChem CID | 158497587 |
| Molecular Formula | C72H130O2 |
| Molecular Weight | 1027.83 g/mol |
| Exact Mass | 1027.01 |
| IUPAC Name | (6Z,9Z,27Z,30Z)-hexatriaconta-6,9,27,30-tetraen-18-ol;(6Z,9Z,27Z,30Z)-hexatriaconta-6,9,27,30-tetraen-18-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(=O)CCCCCCC/C=C\C/C=C\CCCCC.CCCCC/C=C\C/C=C\CCCCCCCCC(O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C36H66O.C36H64O/c2*1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-36(37)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,36-37H,3-10,15-16,21-35H2,1-2H3;11-14,17-20H,3-10,15-16,21-35H2,1-2H3/b2*13-11-,14-12-,19-17-,20-18- |
| InChIKey | HJMICJAPINMQMZ-WELCXFMGSA-N |
| XLogP | 24.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.83 |
| LogP ≤ 5 | 24.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|