C22H40O2 — CID 58736787
(13Z,16Z)-3-hydroxydocosa-13,16-dien-5-one (PubChem CID 58736787) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is (13Z,16Z)-3-hydroxydocosa-13,16-dien-5-one.
| Compound Name | (13Z,16Z)-3-hydroxydocosa-13,16-dien-5-one |
|---|---|
| PubChem CID | 58736787 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | (13Z,16Z)-3-hydroxydocosa-13,16-dien-5-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)CC(O)CC |
| InChI | InChI=1S/C22H40O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(24)20-21(23)4-2/h8-9,11-12,21,23H,3-7,10,13-20H2,1-2H3/b9-8-,12-11- |
| InChIKey | ZXYOQOMXHLZNNU-MURFETPASA-N |
| XLogP | 6.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|