C19H34O — CID 10333807
(10E,13E)-nonadeca-10,13-dien-2-one (PubChem CID 10333807) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is (10E,13E)-nonadeca-10,13-dien-2-one.
| Compound Name | (10E,13E)-nonadeca-10,13-dien-2-one |
|---|---|
| PubChem CID | 10333807 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | (10E,13E)-nonadeca-10,13-dien-2-one |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(C)=O |
| InChI | InChI=1S/C19H34O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)20/h7-8,10-11H,3-6,9,12-18H2,1-2H3/b8-7+,11-10+ |
| InChIKey | NYNXWWRZOOJQQC-ZDVGBALWSA-N |
| XLogP | 6.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|