C20H34O — CID 59917255
(10Z,13Z,16Z)-icosa-10,13,16-trien-2-one (PubChem CID 59917255) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (10Z,13Z,16Z)-icosa-10,13,16-trien-2-one.
| Compound Name | (10Z,13Z,16Z)-icosa-10,13,16-trien-2-one |
|---|---|
| PubChem CID | 59917255 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (10Z,13Z,16Z)-icosa-10,13,16-trien-2-one |
| SMILES | CCC/C=C\C/C=C\C/C=C\CCCCCCCC(C)=O |
| InChI | InChI=1S/C20H34O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)21/h5-6,8-9,11-12H,3-4,7,10,13-19H2,1-2H3/b6-5-,9-8-,12-11- |
| InChIKey | OJFVLICGUWBRQN-AGRJPVHOSA-N |
| XLogP | 6.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|