C22H36O — CID 87555668
(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraen-2-one (PubChem CID 87555668) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraen-2-one.
| Compound Name | (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraen-2-one |
|---|---|
| PubChem CID | 87555668 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraen-2-one |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(C)=O |
| InChI | InChI=1S/C22H36O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2)23/h7-8,10-11,13-14,16-17H,3-6,9,12,15,18-21H2,1-2H3/b8-7-,11-10-,14-13-,17-16- |
| InChIKey | YKOFXGJXRXIKBY-ZKWNWVNESA-N |
| XLogP | 7.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|