About disodium;hydride;(Z)-nonadec-10-en-2-one
disodium;hydride;(Z)-nonadec-10-en-2-one (PubChem CID 175011557) has the molecular formula C19H38Na2O
and a molecular weight of 328.49 g/mol. Its IUPAC name is disodium;hydride;(Z)-nonadec-10-en-2-one.
Molecular Properties
| Compound Name | disodium;hydride;(Z)-nonadec-10-en-2-one |
| PubChem CID | 175011557 |
| Molecular Formula | C19H38Na2O |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | disodium;hydride;(Z)-nonadec-10-en-2-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(C)=O.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C19H36O.2Na.2H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)20;;;;/h10-11H,3-9,12-18H2,1-2H3;;;;/q;2*+1;2*-1/b11-10-;;;; |
| InChIKey | QRYLYOGPMNYICD-LJRJUWJMSA-N |
| XLogP | 0.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze disodium;hydride;(Z)-nonadec-10-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;hydride;(Z)-nonadec-10-en-2-one?
The IUPAC name of disodium;hydride;(Z)-nonadec-10-en-2-one (CID 175011557) is disodium;hydride;(Z)-nonadec-10-en-2-one.
What is the SMILES notation for disodium;hydride;(Z)-nonadec-10-en-2-one?
The canonical SMILES for disodium;hydride;(Z)-nonadec-10-en-2-one is CCCCCCCC/C=C\CCCCCCCC(C)=O.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;hydride;(Z)-nonadec-10-en-2-one?
The InChIKey is QRYLYOGPMNYICD-LJRJUWJMSA-N. The full InChI is InChI=1S/C19H36O.2Na.2H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)20;;;;/h10-11H,3-9,12-18H2,1-2H3;;;;/q;2*+1;2*-1/b11-10-;;;;.
What are the key properties of disodium;hydride;(Z)-nonadec-10-en-2-one?
disodium;hydride;(Z)-nonadec-10-en-2-one has a molecular weight of 328.49 g/mol, XLogP of 0.85, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;hydride;(Z)-nonadec-10-en-2-one is sourced from PubChem (CID 175011557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).