About nonadeca-9,11-dien-2-one
nonadeca-9,11-dien-2-one (PubChem CID 76564066) has the molecular formula C19H34O
and a molecular weight of 278.48 g/mol. Its IUPAC name is nonadeca-9,11-dien-2-one.
Molecular Properties
| Compound Name | nonadeca-9,11-dien-2-one |
| PubChem CID | 76564066 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | nonadeca-9,11-dien-2-one |
| SMILES | CCCCCCCC=CC=CCCCCCCC(C)=O |
| InChI | InChI=1S/C19H34O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)20/h9-12H,3-8,13-18H2,1-2H3 |
| InChIKey | CWCYDQVLRMBWCL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze nonadeca-9,11-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonadeca-9,11-dien-2-one?
The IUPAC name of nonadeca-9,11-dien-2-one (CID 76564066) is nonadeca-9,11-dien-2-one.
What is the SMILES notation for nonadeca-9,11-dien-2-one?
The canonical SMILES for nonadeca-9,11-dien-2-one is CCCCCCCC=CC=CCCCCCCC(C)=O.
What is the InChIKey of nonadeca-9,11-dien-2-one?
The InChIKey is CWCYDQVLRMBWCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)20/h9-12H,3-8,13-18H2,1-2H3.
What are the key properties of nonadeca-9,11-dien-2-one?
nonadeca-9,11-dien-2-one has a molecular weight of 278.48 g/mol, XLogP of 6.39, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonadeca-9,11-dien-2-one is sourced from PubChem (CID 76564066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).