About hexadec-8-ene-2,15-dione
hexadec-8-ene-2,15-dione (PubChem CID 91429732) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is hexadec-8-ene-2,15-dione.
Molecular Properties
| Compound Name | hexadec-8-ene-2,15-dione |
| PubChem CID | 91429732 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | hexadec-8-ene-2,15-dione |
| SMILES | CC(=O)CCCCCC=CCCCCCC(C)=O |
| InChI | InChI=1S/C16H28O2/c1-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(2)18/h3-4H,5-14H2,1-2H3 |
| InChIKey | BEWWHEQULZSWGD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hexadec-8-ene-2,15-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadec-8-ene-2,15-dione?
The IUPAC name of hexadec-8-ene-2,15-dione (CID 91429732) is hexadec-8-ene-2,15-dione.
What is the SMILES notation for hexadec-8-ene-2,15-dione?
The canonical SMILES for hexadec-8-ene-2,15-dione is CC(=O)CCCCCC=CCCCCCC(C)=O.
What is the InChIKey of hexadec-8-ene-2,15-dione?
The InChIKey is BEWWHEQULZSWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c1-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(2)18/h3-4H,5-14H2,1-2H3.
What are the key properties of hexadec-8-ene-2,15-dione?
hexadec-8-ene-2,15-dione has a molecular weight of 252.40 g/mol, XLogP of 4.62, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadec-8-ene-2,15-dione is sourced from PubChem (CID 91429732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).