C20H36O2 — CID 10990494
(8Z,11Z)-18-hydroxyicosa-8,11-dien-2-one (PubChem CID 10990494) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (8Z,11Z)-18-hydroxyicosa-8,11-dien-2-one.
| Compound Name | (8Z,11Z)-18-hydroxyicosa-8,11-dien-2-one |
|---|---|
| PubChem CID | 10990494 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (8Z,11Z)-18-hydroxyicosa-8,11-dien-2-one |
| SMILES | CCC(O)CCCCC/C=C\C/C=C\CCCCCC(C)=O |
| InChI | InChI=1S/C20H36O2/c1-3-20(22)18-16-14-12-10-8-6-4-5-7-9-11-13-15-17-19(2)21/h5-8,20,22H,3-4,9-18H2,1-2H3/b7-5-,8-6- |
| InChIKey | MBJDIBMNNSZSEZ-SFECMWDFSA-N |
| XLogP | 5.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|