About 11-hydroxytridecan-2-one
11-hydroxytridecan-2-one (PubChem CID 11687152) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 11-hydroxytridecan-2-one.
Molecular Properties
| Compound Name | 11-hydroxytridecan-2-one |
| PubChem CID | 11687152 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 11-hydroxytridecan-2-one |
| SMILES | CCC(O)CCCCCCCCC(C)=O |
| InChI | InChI=1S/C13H26O2/c1-3-13(15)11-9-7-5-4-6-8-10-12(2)14/h13,15H,3-11H2,1-2H3 |
| InChIKey | ZJLOBTJQHMOYQX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11-hydroxytridecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-hydroxytridecan-2-one?
The IUPAC name of 11-hydroxytridecan-2-one (CID 11687152) is 11-hydroxytridecan-2-one.
What is the SMILES notation for 11-hydroxytridecan-2-one?
The canonical SMILES for 11-hydroxytridecan-2-one is CCC(O)CCCCCCCCC(C)=O.
What is the InChIKey of 11-hydroxytridecan-2-one?
The InChIKey is ZJLOBTJQHMOYQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-3-13(15)11-9-7-5-4-6-8-10-12(2)14/h13,15H,3-11H2,1-2H3.
What are the key properties of 11-hydroxytridecan-2-one?
11-hydroxytridecan-2-one has a molecular weight of 214.35 g/mol, XLogP of 3.47, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-hydroxytridecan-2-one is sourced from PubChem (CID 11687152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).