C19H38O3 — CID 164804782
10,13-dihydroxynonadecan-2-one (PubChem CID 164804782) has the molecular formula C19H38O3 and a molecular weight of 314.51 g/mol. Its IUPAC name is 10,13-dihydroxynonadecan-2-one.
| Compound Name | 10,13-dihydroxynonadecan-2-one |
|---|---|
| PubChem CID | 164804782 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 10,13-dihydroxynonadecan-2-one |
| SMILES | CCCCCCC(O)CCC(O)CCCCCCCC(C)=O |
| InChI | InChI=1S/C19H38O3/c1-3-4-5-10-13-18(21)15-16-19(22)14-11-8-6-7-9-12-17(2)20/h18-19,21-22H,3-16H2,1-2H3 |
| InChIKey | RNNVAEZVVATEMZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|