C30H56O — CID 126495161
(20Z,23Z)-triaconta-20,23-dien-10-one (PubChem CID 126495161) has the molecular formula C30H56O and a molecular weight of 432.78 g/mol. Its IUPAC name is (20Z,23Z)-triaconta-20,23-dien-10-one.
| Compound Name | (20Z,23Z)-triaconta-20,23-dien-10-one |
|---|---|
| PubChem CID | 126495161 |
| Molecular Formula | C30H56O |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 432.43 |
| IUPAC Name | (20Z,23Z)-triaconta-20,23-dien-10-one |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)CCCCCCCCC |
| InChI | InChI=1S/C30H56O/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-23-25-27-29-30(31)28-26-24-22-10-8-6-4-2/h12-13,15-16H,3-11,14,17-29H2,1-2H3/b13-12-,16-15- |
| InChIKey | DKDFNPUJYBGSRX-QGLGPCELSA-N |
| XLogP | 10.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|