C24H44O — CID 123873281
tetracosa-20,23-dien-10-one (PubChem CID 123873281) has the molecular formula C24H44O and a molecular weight of 348.62 g/mol. Its IUPAC name is tetracosa-20,23-dien-10-one.
| Compound Name | tetracosa-20,23-dien-10-one |
|---|---|
| PubChem CID | 123873281 |
| Molecular Formula | C24H44O |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.34 |
| IUPAC Name | tetracosa-20,23-dien-10-one |
| SMILES | C=CCC=CCCCCCCCCCC(=O)CCCCCCCCC |
| InChI | InChI=1S/C24H44O/c1-3-5-7-9-11-12-13-14-15-17-19-21-23-24(25)22-20-18-16-10-8-6-4-2/h3,7,9H,1,4-6,8,10-23H2,2H3 |
| InChIKey | PTLHGLSZOMWPPH-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|