About tricos-1-en-11-one
tricos-1-en-11-one (PubChem CID 146680996) has the molecular formula C23H44O
and a molecular weight of 336.60 g/mol. Its IUPAC name is tricos-1-en-11-one.
Molecular Properties
| Compound Name | tricos-1-en-11-one |
| PubChem CID | 146680996 |
| Molecular Formula | C23H44O |
| Molecular Weight | 336.60 g/mol |
| Exact Mass | 336.34 |
| IUPAC Name | tricos-1-en-11-one |
| SMILES | C=CCCCCCCCCC(=O)CCCCCCCCCCCC |
| InChI | InChI=1S/C23H44O/c1-3-5-7-9-11-13-14-16-18-20-22-23(24)21-19-17-15-12-10-8-6-4-2/h4H,2-3,5-22H2,1H3 |
| InChIKey | KMFCPIAVJLOMMO-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.60 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricos-1-en-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricos-1-en-11-one?
The IUPAC name of tricos-1-en-11-one (CID 146680996) is tricos-1-en-11-one.
What is the SMILES notation for tricos-1-en-11-one?
The canonical SMILES for tricos-1-en-11-one is C=CCCCCCCCCC(=O)CCCCCCCCCCCC.
What is the InChIKey of tricos-1-en-11-one?
The InChIKey is KMFCPIAVJLOMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H44O/c1-3-5-7-9-11-13-14-16-18-20-22-23(24)21-19-17-15-12-10-8-6-4-2/h4H,2-3,5-22H2,1H3.
What are the key properties of tricos-1-en-11-one?
tricos-1-en-11-one has a molecular weight of 336.60 g/mol, XLogP of 8.17, 20 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricos-1-en-11-one is sourced from PubChem (CID 146680996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).