About pentacos-1-en-11-one
pentacos-1-en-11-one (PubChem CID 21420755) has the molecular formula C25H48O
and a molecular weight of 364.66 g/mol. Its IUPAC name is pentacos-1-en-11-one.
Molecular Properties
| Compound Name | pentacos-1-en-11-one |
| PubChem CID | 21420755 |
| Molecular Formula | C25H48O |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.37 |
| IUPAC Name | pentacos-1-en-11-one |
| SMILES | C=CCCCCCCCCC(=O)CCCCCCCCCCCCCC |
| InChI | InChI=1S/C25H48O/c1-3-5-7-9-11-13-14-15-16-18-20-22-24-25(26)23-21-19-17-12-10-8-6-4-2/h4H,2-3,5-24H2,1H3 |
| InChIKey | MRZLYZFWARBILB-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pentacos-1-en-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacos-1-en-11-one?
The IUPAC name of pentacos-1-en-11-one (CID 21420755) is pentacos-1-en-11-one.
What is the SMILES notation for pentacos-1-en-11-one?
The canonical SMILES for pentacos-1-en-11-one is C=CCCCCCCCCC(=O)CCCCCCCCCCCCCC.
What is the InChIKey of pentacos-1-en-11-one?
The InChIKey is MRZLYZFWARBILB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H48O/c1-3-5-7-9-11-13-14-15-16-18-20-22-24-25(26)23-21-19-17-12-10-8-6-4-2/h4H,2-3,5-24H2,1H3.
What are the key properties of pentacos-1-en-11-one?
pentacos-1-en-11-one has a molecular weight of 364.66 g/mol, XLogP of 8.95, 22 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentacos-1-en-11-one is sourced from PubChem (CID 21420755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).