About tricosa-1,22-dien-12-one
tricosa-1,22-dien-12-one (PubChem CID 86210796) has the molecular formula C23H42O
and a molecular weight of 334.59 g/mol. Its IUPAC name is tricosa-1,22-dien-12-one.
Molecular Properties
| Compound Name | tricosa-1,22-dien-12-one |
| PubChem CID | 86210796 |
| Molecular Formula | C23H42O |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.32 |
| IUPAC Name | tricosa-1,22-dien-12-one |
| SMILES | C=CCCCCCCCCCC(=O)CCCCCCCCCC=C |
| InChI | InChI=1S/C23H42O/c1-3-5-7-9-11-13-15-17-19-21-23(24)22-20-18-16-14-12-10-8-6-4-2/h3-4H,1-2,5-22H2 |
| InChIKey | XSXGPOWIKPOMRY-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricosa-1,22-dien-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricosa-1,22-dien-12-one?
The IUPAC name of tricosa-1,22-dien-12-one (CID 86210796) is tricosa-1,22-dien-12-one.
What is the SMILES notation for tricosa-1,22-dien-12-one?
The canonical SMILES for tricosa-1,22-dien-12-one is C=CCCCCCCCCCC(=O)CCCCCCCCCC=C.
What is the InChIKey of tricosa-1,22-dien-12-one?
The InChIKey is XSXGPOWIKPOMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H42O/c1-3-5-7-9-11-13-15-17-19-21-23(24)22-20-18-16-14-12-10-8-6-4-2/h3-4H,1-2,5-22H2.
What are the key properties of tricosa-1,22-dien-12-one?
tricosa-1,22-dien-12-one has a molecular weight of 334.59 g/mol, XLogP of 7.95, 20 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricosa-1,22-dien-12-one is sourced from PubChem (CID 86210796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).