About pentadec-14-enoyl bromide
pentadec-14-enoyl bromide (PubChem CID 155164033) has the molecular formula C15H27BrO
and a molecular weight of 303.28 g/mol. Its IUPAC name is pentadec-14-enoyl bromide.
Molecular Properties
| Compound Name | pentadec-14-enoyl bromide |
| PubChem CID | 155164033 |
| Molecular Formula | C15H27BrO |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | pentadec-14-enoyl bromide |
| SMILES | C=CCCCCCCCCCCCCC(=O)Br |
| InChI | InChI=1S/C15H27BrO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2H,1,3-14H2 |
| InChIKey | MGKBGODILZNKNG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pentadec-14-enoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadec-14-enoyl bromide?
The IUPAC name of pentadec-14-enoyl bromide (CID 155164033) is pentadec-14-enoyl bromide.
What is the SMILES notation for pentadec-14-enoyl bromide?
The canonical SMILES for pentadec-14-enoyl bromide is C=CCCCCCCCCCCCCC(=O)Br.
What is the InChIKey of pentadec-14-enoyl bromide?
The InChIKey is MGKBGODILZNKNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27BrO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2H,1,3-14H2.
What are the key properties of pentadec-14-enoyl bromide?
pentadec-14-enoyl bromide has a molecular weight of 303.28 g/mol, XLogP of 5.78, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentadec-14-enoyl bromide is sourced from PubChem (CID 155164033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).