About undeca-1,10-dien-3-one
undeca-1,10-dien-3-one (PubChem CID 152625957) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is undeca-1,10-dien-3-one.
Molecular Properties
| Compound Name | undeca-1,10-dien-3-one |
| PubChem CID | 152625957 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | undeca-1,10-dien-3-one |
| SMILES | C=CCCCCCCC(=O)C=C |
| InChI | InChI=1S/C11H18O/c1-3-5-6-7-8-9-10-11(12)4-2/h3-4H,1-2,5-10H2 |
| InChIKey | ZCNDBDLXNPQNAH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze undeca-1,10-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undeca-1,10-dien-3-one?
The IUPAC name of undeca-1,10-dien-3-one (CID 152625957) is undeca-1,10-dien-3-one.
What is the SMILES notation for undeca-1,10-dien-3-one?
The canonical SMILES for undeca-1,10-dien-3-one is C=CCCCCCCC(=O)C=C.
What is the InChIKey of undeca-1,10-dien-3-one?
The InChIKey is ZCNDBDLXNPQNAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-3-5-6-7-8-9-10-11(12)4-2/h3-4H,1-2,5-10H2.
What are the key properties of undeca-1,10-dien-3-one?
undeca-1,10-dien-3-one has a molecular weight of 166.26 g/mol, XLogP of 3.27, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undeca-1,10-dien-3-one is sourced from PubChem (CID 152625957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).