About nonadec-1-en-3-one
nonadec-1-en-3-one (PubChem CID 3326465) has the molecular formula C19H36O
and a molecular weight of 280.50 g/mol. Its IUPAC name is nonadec-1-en-3-one.
Molecular Properties
| Compound Name | nonadec-1-en-3-one |
| PubChem CID | 3326465 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | nonadec-1-en-3-one |
| SMILES | C=CC(=O)CCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C19H36O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)4-2/h4H,2-3,5-18H2,1H3 |
| InChIKey | IBRGPZKSIDNEFH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze nonadec-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonadec-1-en-3-one?
The IUPAC name of nonadec-1-en-3-one (CID 3326465) is nonadec-1-en-3-one.
What is the SMILES notation for nonadec-1-en-3-one?
The canonical SMILES for nonadec-1-en-3-one is C=CC(=O)CCCCCCCCCCCCCCCC.
What is the InChIKey of nonadec-1-en-3-one?
The InChIKey is IBRGPZKSIDNEFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)4-2/h4H,2-3,5-18H2,1H3.
What are the key properties of nonadec-1-en-3-one?
nonadec-1-en-3-one has a molecular weight of 280.50 g/mol, XLogP of 6.61, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonadec-1-en-3-one is sourced from PubChem (CID 3326465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).