C21H36O2 — CID 56936226
(7E,9E)-henicosa-7,9-diene-6,11-dione (PubChem CID 56936226) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (7E,9E)-henicosa-7,9-diene-6,11-dione.
| Compound Name | (7E,9E)-henicosa-7,9-diene-6,11-dione |
|---|---|
| PubChem CID | 56936226 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (7E,9E)-henicosa-7,9-diene-6,11-dione |
| SMILES | CCCCCCCCCCC(=O)/C=C/C=C/C(=O)CCCCC |
| InChI | InChI=1S/C21H36O2/c1-3-5-7-8-9-10-11-13-17-21(23)19-15-14-18-20(22)16-12-6-4-2/h14-15,18-19H,3-13,16-17H2,1-2H3/b18-14+,19-15+ |
| InChIKey | KNBTZQJOALZUDH-JSAVKQRWSA-N |
| XLogP | 6.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|