C18H30O — CID 154172928
octadeca-2,4,6-trien-8-one (PubChem CID 154172928) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is octadeca-2,4,6-trien-8-one.
| Compound Name | octadeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 154172928 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | octadeca-2,4,6-trien-8-one |
| SMILES | CC=CC=CC=CC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C18H30O/c1-3-5-7-9-10-11-13-15-17-18(19)16-14-12-8-6-4-2/h4,6,8,12,14,16H,3,5,7,9-11,13,15,17H2,1-2H3 |
| InChIKey | KTEFGJAEYVQYFY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|