C12H20O — CID 71412707
dodeca-2,4-dien-6-one (PubChem CID 71412707) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is dodeca-2,4-dien-6-one.
| Compound Name | dodeca-2,4-dien-6-one |
|---|---|
| PubChem CID | 71412707 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | dodeca-2,4-dien-6-one |
| SMILES | CC=CC=CC(=O)CCCCCC |
| InChI | InChI=1S/C12H20O/c1-3-5-7-9-11-12(13)10-8-6-4-2/h4,6,8,10H,3,5,7,9,11H2,1-2H3 |
| InChIKey | JGTUFUAPYRTOFF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|