About (E)-undec-2-en-4-one
(E)-undec-2-en-4-one (PubChem CID 11550066) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is (E)-undec-2-en-4-one.
Molecular Properties
| Compound Name | (E)-undec-2-en-4-one |
| PubChem CID | 11550066 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (E)-undec-2-en-4-one |
| SMILES | C/C=C/C(=O)CCCCCCC |
| InChI | InChI=1S/C11H20O/c1-3-5-6-7-8-10-11(12)9-4-2/h4,9H,3,5-8,10H2,1-2H3/b9-4+ |
| InChIKey | XKZRHGWZYDQHSN-RUDMXATFSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-undec-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-undec-2-en-4-one?
The IUPAC name of (E)-undec-2-en-4-one (CID 11550066) is (E)-undec-2-en-4-one.
What is the SMILES notation for (E)-undec-2-en-4-one?
The canonical SMILES for (E)-undec-2-en-4-one is C/C=C/C(=O)CCCCCCC.
What is the InChIKey of (E)-undec-2-en-4-one?
The InChIKey is XKZRHGWZYDQHSN-RUDMXATFSA-N. The full InChI is InChI=1S/C11H20O/c1-3-5-6-7-8-10-11(12)9-4-2/h4,9H,3,5-8,10H2,1-2H3/b9-4+.
What are the key properties of (E)-undec-2-en-4-one?
(E)-undec-2-en-4-one has a molecular weight of 168.28 g/mol, XLogP of 3.49, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-undec-2-en-4-one is sourced from PubChem (CID 11550066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).