About (E)-henicos-9-en-11-one
(E)-henicos-9-en-11-one (PubChem CID 6366356) has the molecular formula C21H40O
and a molecular weight of 308.55 g/mol. Its IUPAC name is (E)-henicos-9-en-11-one.
Molecular Properties
| Compound Name | (E)-henicos-9-en-11-one |
| PubChem CID | 6366356 |
| Molecular Formula | C21H40O |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.31 |
| IUPAC Name | (E)-henicos-9-en-11-one |
| SMILES | CCCCCCCC/C=C/C(=O)CCCCCCCCCC |
| InChI | InChI=1S/C21H40O/c1-3-5-7-9-11-13-15-17-19-21(22)20-18-16-14-12-10-8-6-4-2/h17,19H,3-16,18,20H2,1-2H3/b19-17+ |
| InChIKey | KIIMLDAHZVVLHQ-HTXNQAPBSA-N |
| XLogP | 7.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-henicos-9-en-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-henicos-9-en-11-one?
The IUPAC name of (E)-henicos-9-en-11-one (CID 6366356) is (E)-henicos-9-en-11-one.
What is the SMILES notation for (E)-henicos-9-en-11-one?
The canonical SMILES for (E)-henicos-9-en-11-one is CCCCCCCC/C=C/C(=O)CCCCCCCCCC.
What is the InChIKey of (E)-henicos-9-en-11-one?
The InChIKey is KIIMLDAHZVVLHQ-HTXNQAPBSA-N. The full InChI is InChI=1S/C21H40O/c1-3-5-7-9-11-13-15-17-19-21(22)20-18-16-14-12-10-8-6-4-2/h17,19H,3-16,18,20H2,1-2H3/b19-17+.
What are the key properties of (E)-henicos-9-en-11-one?
(E)-henicos-9-en-11-one has a molecular weight of 308.55 g/mol, XLogP of 7.39, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-henicos-9-en-11-one is sourced from PubChem (CID 6366356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).