C21H34O2 — CID 91135390
4-oxohenicosa-5,12,15-trienal (PubChem CID 91135390) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 4-oxohenicosa-5,12,15-trienal.
| Compound Name | 4-oxohenicosa-5,12,15-trienal |
|---|---|
| PubChem CID | 91135390 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 4-oxohenicosa-5,12,15-trienal |
| SMILES | CCCCCC=CCC=CCCCCCC=CC(=O)CCC=O |
| InChI | InChI=1S/C21H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21(23)19-17-20-22/h6-7,9-10,16,18,20H,2-5,8,11-15,17,19H2,1H3 |
| InChIKey | YREYEVUFYCFGEC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|