About (E)-6-oxopentadec-4-enal
(E)-6-oxopentadec-4-enal (PubChem CID 10988341) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is (E)-6-oxopentadec-4-enal.
Molecular Properties
| Compound Name | (E)-6-oxopentadec-4-enal |
| PubChem CID | 10988341 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (E)-6-oxopentadec-4-enal |
| SMILES | CCCCCCCCCC(=O)/C=C/CCC=O |
| InChI | InChI=1S/C15H26O2/c1-2-3-4-5-6-7-9-12-15(17)13-10-8-11-14-16/h10,13-14H,2-9,11-12H2,1H3/b13-10+ |
| InChIKey | PUZKGEDNHWMMOS-JLHYYAGUSA-N |
| XLogP | 4.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-oxopentadec-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-oxopentadec-4-enal?
The IUPAC name of (E)-6-oxopentadec-4-enal (CID 10988341) is (E)-6-oxopentadec-4-enal.
What is the SMILES notation for (E)-6-oxopentadec-4-enal?
The canonical SMILES for (E)-6-oxopentadec-4-enal is CCCCCCCCCC(=O)/C=C/CCC=O.
What is the InChIKey of (E)-6-oxopentadec-4-enal?
The InChIKey is PUZKGEDNHWMMOS-JLHYYAGUSA-N. The full InChI is InChI=1S/C15H26O2/c1-2-3-4-5-6-7-9-12-15(17)13-10-8-11-14-16/h10,13-14H,2-9,11-12H2,1H3/b13-10+.
What are the key properties of (E)-6-oxopentadec-4-enal?
(E)-6-oxopentadec-4-enal has a molecular weight of 238.37 g/mol, XLogP of 4.23, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-oxopentadec-4-enal is sourced from PubChem (CID 10988341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).