C19H34O — CID 151605854
nonadeca-2,12-dien-4-one (PubChem CID 151605854) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is nonadeca-2,12-dien-4-one.
| Compound Name | nonadeca-2,12-dien-4-one |
|---|---|
| PubChem CID | 151605854 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | nonadeca-2,12-dien-4-one |
| SMILES | CC=CC(=O)CCCCCCCC=CCCCCCC |
| InChI | InChI=1S/C19H34O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-18-19(20)17-4-2/h4,9-10,17H,3,5-8,11-16,18H2,1-2H3 |
| InChIKey | QLLKADYWUSBVHR-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|