About (E)-triacont-15-ene-8,23-dione
(E)-triacont-15-ene-8,23-dione (PubChem CID 11849500) has the molecular formula C30H56O2
and a molecular weight of 448.78 g/mol. Its IUPAC name is (E)-triacont-15-ene-8,23-dione.
Molecular Properties
| Compound Name | (E)-triacont-15-ene-8,23-dione |
| PubChem CID | 11849500 |
| Molecular Formula | C30H56O2 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 448.43 |
| IUPAC Name | (E)-triacont-15-ene-8,23-dione |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/CCCCCCC(=O)CCCCCCC |
| InChI | InChI=1S/C30H56O2/c1-3-5-7-17-21-25-29(31)27-23-19-15-13-11-9-10-12-14-16-20-24-28-30(32)26-22-18-8-6-4-2/h9-10H,3-8,11-28H2,1-2H3/b10-9+ |
| InChIKey | RKSJJMAIFSNTQX-MDZDMXLPSA-N |
| XLogP | 10.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-triacont-15-ene-8,23-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-triacont-15-ene-8,23-dione?
The IUPAC name of (E)-triacont-15-ene-8,23-dione (CID 11849500) is (E)-triacont-15-ene-8,23-dione.
What is the SMILES notation for (E)-triacont-15-ene-8,23-dione?
The canonical SMILES for (E)-triacont-15-ene-8,23-dione is CCCCCCCC(=O)CCCCCC/C=C/CCCCCCC(=O)CCCCCCC.
What is the InChIKey of (E)-triacont-15-ene-8,23-dione?
The InChIKey is RKSJJMAIFSNTQX-MDZDMXLPSA-N. The full InChI is InChI=1S/C30H56O2/c1-3-5-7-17-21-25-29(31)27-23-19-15-13-11-9-10-12-14-16-20-24-28-30(32)26-22-18-8-6-4-2/h9-10H,3-8,11-28H2,1-2H3/b10-9+.
What are the key properties of (E)-triacont-15-ene-8,23-dione?
(E)-triacont-15-ene-8,23-dione has a molecular weight of 448.78 g/mol, XLogP of 10.08, 26 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-triacont-15-ene-8,23-dione is sourced from PubChem (CID 11849500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).