About (Z)-hexadec-9-enethioic S-acid
(Z)-hexadec-9-enethioic S-acid (PubChem CID 121337660) has the molecular formula C16H30OS
and a molecular weight of 270.48 g/mol. Its IUPAC name is (Z)-hexadec-9-enethioic S-acid.
Molecular Properties
| Compound Name | (Z)-hexadec-9-enethioic S-acid |
| PubChem CID | 121337660 |
| Molecular Formula | C16H30OS |
| Molecular Weight | 270.48 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (Z)-hexadec-9-enethioic S-acid |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)S |
| InChI | InChI=1S/C16H30OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7- |
| InChIKey | VVTYRXAKRGTCKO-FPLPWBNLSA-N |
| XLogP | 5.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-hexadec-9-enethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-hexadec-9-enethioic S-acid?
The IUPAC name of (Z)-hexadec-9-enethioic S-acid (CID 121337660) is (Z)-hexadec-9-enethioic S-acid.
What is the SMILES notation for (Z)-hexadec-9-enethioic S-acid?
The canonical SMILES for (Z)-hexadec-9-enethioic S-acid is CCCCCC/C=C\CCCCCCCC(=O)S.
What is the InChIKey of (Z)-hexadec-9-enethioic S-acid?
The InChIKey is VVTYRXAKRGTCKO-FPLPWBNLSA-N. The full InChI is InChI=1S/C16H30OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7-.
What are the key properties of (Z)-hexadec-9-enethioic S-acid?
(Z)-hexadec-9-enethioic S-acid has a molecular weight of 270.48 g/mol, XLogP of 5.70, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-hexadec-9-enethioic S-acid is sourced from PubChem (CID 121337660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).